C13H17N3O6S — CID 10337486
dimethyl 2-[[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-methylsulfanylmethylidene]propanedioate (PubChem CID 10337486) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is dimethyl 2-[[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-methylsulfanylmethylidene]propanedioate.
| Compound Name | dimethyl 2-[[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-methylsulfanylmethylidene]propanedioate |
|---|---|
| PubChem CID | 10337486 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | dimethyl 2-[[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-methylsulfanylmethylidene]propanedioate |
| SMILES | CCOC(=O)c1cn[nH]c1NC(SC)=C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H17N3O6S/c1-5-22-11(17)7-6-14-16-9(7)15-10(23-4)8(12(18)20-2)13(19)21-3/h6H,5H2,1-4H3,(H2,14,15,16) |
| InChIKey | AJMVWRXDQYHXMX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|