C7H9N3O3S — CID 135528316
ethyl 5-(hydroxycarbamothioyl)-1H-pyrazole-4-carboxylate (PubChem CID 135528316) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is ethyl 5-(hydroxycarbamothioyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(hydroxycarbamothioyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135528316 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | ethyl 5-(hydroxycarbamothioyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1C(=S)NO |
| InChI | InChI=1S/C7H9N3O3S/c1-2-13-7(11)4-3-8-9-5(4)6(14)10-12/h3,12H,2H2,1H3,(H,8,9)(H,10,14) |
| InChIKey | ZPSUMNCAPVGPCF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|