C10H16N4O3 — CID 110479995
ethyl 5-[(2-amino-2-methylpropanoyl)amino]-1H-pyrazole-4-carboxylate (PubChem CID 110479995) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl 5-[(2-amino-2-methylpropanoyl)amino]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-amino-2-methylpropanoyl)amino]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 110479995 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | ethyl 5-[(2-amino-2-methylpropanoyl)amino]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1NC(=O)C(C)(C)N |
| InChI | InChI=1S/C10H16N4O3/c1-4-17-8(15)6-5-12-14-7(6)13-9(16)10(2,3)11/h5H,4,11H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | BFJSJSRPGOGXMG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |