C23H30N2O3 — CID 126842843
2-(diethylaminomethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol (PubChem CID 126842843) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol.
| Compound Name | 2-(diethylaminomethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 126842843 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-(diethylaminomethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol |
| SMILES | CCN(CC)Cc1ccc(/C=C/c2cnc(C)c3c2COC(C)(C)O3)cc1O |
| InChI | InChI=1S/C23H30N2O3/c1-6-25(7-2)14-19-11-9-17(12-21(19)26)8-10-18-13-24-16(3)22-20(18)15-27-23(4,5)28-22/h8-13,26H,6-7,14-15H2,1-5H3/b10-8+ |
| InChIKey | LFPZKGJSJKVXOL-CSKARUKUSA-N |
| XLogP | 4.75 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|