C25H35NO3 — CID 44523051
2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-2-yl-3H-chromene-4,5-diol (PubChem CID 44523051) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-2-yl-3H-chromene-4,5-diol.
| Compound Name | 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-2-yl-3H-chromene-4,5-diol |
|---|---|
| PubChem CID | 44523051 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-2-yl-3H-chromene-4,5-diol |
| SMILES | CCCCCC(C)C(C)c1cc(O)c2c(c1)OC(C)(C)CC2(O)c1ccccn1 |
| InChI | InChI=1S/C25H35NO3/c1-6-7-8-11-17(2)18(3)19-14-20(27)23-21(15-19)29-24(4,5)16-25(23,28)22-12-9-10-13-26-22/h9-10,12-15,17-18,27-28H,6-8,11,16H2,1-5H3 |
| InChIKey | WIRCBXZDSUNBRT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|