C23H32ClNO2 — CID 135624410
5,5-dimethyl-8-(3-methyloctan-2-yl)chromeno[3,4-c]pyridin-10-ol;hydrochloride (PubChem CID 135624410) has the molecular formula C23H32ClNO2 and a molecular weight of 389.97 g/mol. Its IUPAC name is 5,5-dimethyl-8-(3-methyloctan-2-yl)chromeno[3,4-c]pyridin-10-ol;hydrochloride.
| Compound Name | 5,5-dimethyl-8-(3-methyloctan-2-yl)chromeno[3,4-c]pyridin-10-ol;hydrochloride |
|---|---|
| PubChem CID | 135624410 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 5,5-dimethyl-8-(3-methyloctan-2-yl)chromeno[3,4-c]pyridin-10-ol;hydrochloride |
| SMILES | CCCCCC(C)C(C)c1cc(O)c2c(c1)OC(C)(C)c1cnccc1-2.Cl |
| InChI | InChI=1S/C23H31NO2.ClH/c1-6-7-8-9-15(2)16(3)17-12-20(25)22-18-10-11-24-14-19(18)23(4,5)26-21(22)13-17;/h10-16,25H,6-9H2,1-5H3;1H |
| InChIKey | CNINHVIJBRVLNE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|