C20H13ClN2O3S3 — CID 126842918
3-chloro-N-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide (PubChem CID 126842918) has the molecular formula C20H13ClN2O3S3 and a molecular weight of 460.99 g/mol. Its IUPAC name is 3-chloro-N-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126842918 |
| Molecular Formula | C20H13ClN2O3S3 |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 3-chloro-N-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(NC(=O)c3sc4ccccc4c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H13ClN2O3S3/c1-26-12-8-6-11(7-9-12)10-15-19(25)23(20(27)29-15)22-18(24)17-16(21)13-4-2-3-5-14(13)28-17/h2-10H,1H3,(H,22,24)/b15-10- |
| InChIKey | JLJHWIXMXGFJRW-GDNBJRDFSA-N |
| XLogP | 5.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|