C28H17ClN4O2S3 — CID 126842914
3-chloro-N-[(5Z)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide (PubChem CID 126842914) has the molecular formula C28H17ClN4O2S3 and a molecular weight of 573.12 g/mol. Its IUPAC name is 3-chloro-N-[(5Z)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(5Z)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126842914 |
| Molecular Formula | C28H17ClN4O2S3 |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | 3-chloro-N-[(5Z)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2ccccc2)SC1=S)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C28H17ClN4O2S3/c29-23-20-13-7-8-14-21(20)37-25(23)26(34)31-33-27(35)22(38-28(33)36)15-18-16-32(19-11-5-2-6-12-19)30-24(18)17-9-3-1-4-10-17/h1-16H,(H,31,34)/b22-15- |
| InChIKey | IHLPCDZWFOJMCR-JCMHNJIXSA-N |
| XLogP | 6.95 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|