C29H23ClN4O2S2 — CID 6524246
2-chloro-N-[(5E)-4-oxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 6524246) has the molecular formula C29H23ClN4O2S2 and a molecular weight of 559.12 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-4-oxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-N-[(5E)-4-oxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 6524246 |
| Molecular Formula | C29H23ClN4O2S2 |
| Molecular Weight | 559.12 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | 2-chloro-N-[(5E)-4-oxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1cc(C)c(-c2nn(-c3ccccc3)cc2/C=C2/SC(=S)N(NC(=O)c3ccccc3Cl)C2=O)c(C)c1 |
| InChI | InChI=1S/C29H23ClN4O2S2/c1-17-13-18(2)25(19(3)14-17)26-20(16-33(31-26)21-9-5-4-6-10-21)15-24-28(36)34(29(37)38-24)32-27(35)22-11-7-8-12-23(22)30/h4-16H,1-3H3,(H,32,35)/b24-15+ |
| InChIKey | KDDVIQLHBBWPJX-BUVRLJJBSA-N |
| XLogP | 6.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.12 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|