C24H44NO3- — CID 126843443
(2S,3S)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]pentanoate (PubChem CID 126843443) has the molecular formula C24H44NO3- and a molecular weight of 394.62 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]pentanoate.
| Compound Name | (2S,3S)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]pentanoate |
|---|---|
| PubChem CID | 126843443 |
| Molecular Formula | C24H44NO3- |
| Molecular Weight | 394.62 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]pentanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](C(=O)[O-])[C@@H](C)CC |
| InChI | InChI=1S/C24H45NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(26)25-23(24(27)28)21(3)5-2/h12-13,21,23H,4-11,14-20H2,1-3H3,(H,25,26)(H,27,28)/p-1/b13-12-/t21-,23-/m0/s1 |
| InChIKey | TYWACVZIFBZIQZ-BSFUXZNJSA-M |
| XLogP | 5.30 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|