C11H20N2O — CID 126845063
1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)pyrrolidin-3-ol (PubChem CID 126845063) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)pyrrolidin-3-ol.
| Compound Name | 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126845063 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl)pyrrolidin-3-ol |
| SMILES | OC1CCN(C2CCC3CNCC32)C1 |
| InChI | InChI=1S/C11H20N2O/c14-9-3-4-13(7-9)11-2-1-8-5-12-6-10(8)11/h8-12,14H,1-7H2 |
| InChIKey | ASGHGNPFSGZYME-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |