C10H20N2O — CID 130685458
(3R)-1-(1,4-dimethylpyrrolidin-3-yl)pyrrolidin-3-ol (PubChem CID 130685458) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (3R)-1-(1,4-dimethylpyrrolidin-3-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(1,4-dimethylpyrrolidin-3-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130685458 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (3R)-1-(1,4-dimethylpyrrolidin-3-yl)pyrrolidin-3-ol |
| SMILES | CC1CN(C)CC1N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H20N2O/c1-8-5-11(2)7-10(8)12-4-3-9(13)6-12/h8-10,13H,3-7H2,1-2H3/t8?,9-,10?/m1/s1 |
| InChIKey | QYRQJGLSQRTZNE-HWOCKDDLSA-N |
| XLogP | 0.00 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |