C15H30N2O4 — CID 126846381
tert-butyl (3R,4R)-3-hydroxy-4-(3-propan-2-yloxypropylamino)pyrrolidine-1-carboxylate (PubChem CID 126846381) has the molecular formula C15H30N2O4 and a molecular weight of 302.41 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-hydroxy-4-(3-propan-2-yloxypropylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-hydroxy-4-(3-propan-2-yloxypropylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126846381 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | tert-butyl (3R,4R)-3-hydroxy-4-(3-propan-2-yloxypropylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)OCCCN[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C15H30N2O4/c1-11(2)20-8-6-7-16-12-9-17(10-13(12)18)14(19)21-15(3,4)5/h11-13,16,18H,6-10H2,1-5H3/t12-,13-/m1/s1 |
| InChIKey | HKQZSEARZQNAFN-CHWSQXEVSA-N |
| XLogP | 1.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|