C16H31N3O4 — CID 126846352
tert-butyl (3R,4R)-3-hydroxy-4-(3-morpholin-4-ylpropylamino)pyrrolidine-1-carboxylate (PubChem CID 126846352) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-hydroxy-4-(3-morpholin-4-ylpropylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-hydroxy-4-(3-morpholin-4-ylpropylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126846352 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | tert-butyl (3R,4R)-3-hydroxy-4-(3-morpholin-4-ylpropylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)[C@H](NCCCN2CCOCC2)C1 |
| InChI | InChI=1S/C16H31N3O4/c1-16(2,3)23-15(21)19-11-13(14(20)12-19)17-5-4-6-18-7-9-22-10-8-18/h13-14,17,20H,4-12H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | ZKEYEYBMJGJWHQ-ZIAGYGMSSA-N |
| XLogP | 0.28 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|