C11H22N2O2 — CID 126846654
(3S,4R)-4-[methyl-(1-methylpiperidin-4-yl)amino]oxolan-3-ol (PubChem CID 126846654) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (3S,4R)-4-[methyl-(1-methylpiperidin-4-yl)amino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[methyl-(1-methylpiperidin-4-yl)amino]oxolan-3-ol |
|---|---|
| PubChem CID | 126846654 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3S,4R)-4-[methyl-(1-methylpiperidin-4-yl)amino]oxolan-3-ol |
| SMILES | CN1CCC(N(C)[C@@H]2COC[C@H]2O)CC1 |
| InChI | InChI=1S/C11H22N2O2/c1-12-5-3-9(4-6-12)13(2)10-7-15-8-11(10)14/h9-11,14H,3-8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | STCZKQWOQKUNCZ-GHMZBOCLSA-N |
| XLogP | -0.23 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |