C5H10N2OS2 — CID 12684688
N'-(2-methoxyethyl)ethanedithioamide (PubChem CID 12684688) has the molecular formula C5H10N2OS2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N'-(2-methoxyethyl)ethanedithioamide.
| Compound Name | N'-(2-methoxyethyl)ethanedithioamide |
|---|---|
| PubChem CID | 12684688 |
| Molecular Formula | C5H10N2OS2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | N'-(2-methoxyethyl)ethanedithioamide |
| SMILES | COCCNC(=S)C(N)=S |
| InChI | InChI=1S/C5H10N2OS2/c1-8-3-2-7-5(10)4(6)9/h2-3H2,1H3,(H2,6,9)(H,7,10) |
| InChIKey | TVKUSPHYWPMQFW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|