C15H13N3O4S — CID 126852085
N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]-N'-(1,2-oxazol-3-yl)oxamide (PubChem CID 126852085) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]-N'-(1,2-oxazol-3-yl)oxamide.
| Compound Name | N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]-N'-(1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 126852085 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]-N'-(1,2-oxazol-3-yl)oxamide |
| SMILES | O=C(NCC(c1ccco1)c1cccs1)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C15H13N3O4S/c19-14(15(20)17-13-5-7-22-18-13)16-9-10(11-3-1-6-21-11)12-4-2-8-23-12/h1-8,10H,9H2,(H,16,19)(H,17,18,20) |
| InChIKey | RAIUPZIXECVNRI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|