C12H26N2 — CID 12685498
2-tert-butyl-1,3,5,5-tetramethyl-1,3-diazinane (PubChem CID 12685498) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-tert-butyl-1,3,5,5-tetramethyl-1,3-diazinane.
| Compound Name | 2-tert-butyl-1,3,5,5-tetramethyl-1,3-diazinane |
|---|---|
| PubChem CID | 12685498 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 2-tert-butyl-1,3,5,5-tetramethyl-1,3-diazinane |
| SMILES | CN1CC(C)(C)CN(C)C1C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-11(2,3)10-13(6)8-12(4,5)9-14(10)7/h10H,8-9H2,1-7H3 |
| InChIKey | IKOBFXOXZHYHBG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |