C10H15N3 — CID 126855791
N-cyclobutyl-N,2-dimethylpyrimidin-4-amine (PubChem CID 126855791) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-cyclobutyl-N,2-dimethylpyrimidin-4-amine.
| Compound Name | N-cyclobutyl-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 126855791 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-cyclobutyl-N,2-dimethylpyrimidin-4-amine |
| SMILES | Cc1nccc(N(C)C2CCC2)n1 |
| InChI | InChI=1S/C10H15N3/c1-8-11-7-6-10(12-8)13(2)9-4-3-5-9/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | SYFJPECFDSZDMM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |