C5H8N4O3 — CID 1268901
4-amino-N,N-dimethyl-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide (PubChem CID 1268901) has the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide.
| Compound Name | 4-amino-N,N-dimethyl-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide |
|---|---|
| PubChem CID | 1268901 |
| Molecular Formula | C5H8N4O3 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 4-amino-N,N-dimethyl-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide |
| SMILES | CN(C)C(=O)c1c(N)no[n+]1[O-] |
| InChI | InChI=1S/C5H8N4O3/c1-8(2)5(10)3-4(6)7-12-9(3)11/h1-2H3,(H2,6,7) |
| InChIKey | UXRPHPGVIAZXCR-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|