C21H31FN4O — CID 126893118
1-[3-[[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]methyl]piperidin-1-yl]ethanone (PubChem CID 126893118) has the molecular formula C21H31FN4O and a molecular weight of 374.50 g/mol. Its IUPAC name is 1-[3-[[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]methyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 126893118 |
| Molecular Formula | C21H31FN4O |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 1-[3-[[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]methyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(CN2CC(N3CCN(c4ccc(F)cc4)CC3)C2)C1 |
| InChI | InChI=1S/C21H31FN4O/c1-17(27)26-8-2-3-18(14-26)13-23-15-21(16-23)25-11-9-24(10-12-25)20-6-4-19(22)5-7-20/h4-7,18,21H,2-3,8-16H2,1H3 |
| InChIKey | OHQYVLSHABBDBC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |