C18H25N5O3S — CID 126894532
1-methylsulfonyl-3-[(4-quinazolin-6-ylpiperazin-1-yl)methyl]pyrrolidin-3-ol (PubChem CID 126894532) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-methylsulfonyl-3-[(4-quinazolin-6-ylpiperazin-1-yl)methyl]pyrrolidin-3-ol.
| Compound Name | 1-methylsulfonyl-3-[(4-quinazolin-6-ylpiperazin-1-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126894532 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-methylsulfonyl-3-[(4-quinazolin-6-ylpiperazin-1-yl)methyl]pyrrolidin-3-ol |
| SMILES | CS(=O)(=O)N1CCC(O)(CN2CCN(c3ccc4ncncc4c3)CC2)C1 |
| InChI | InChI=1S/C18H25N5O3S/c1-27(25,26)23-5-4-18(24,13-23)12-21-6-8-22(9-7-21)16-2-3-17-15(10-16)11-19-14-20-17/h2-3,10-11,14,24H,4-9,12-13H2,1H3 |
| InChIKey | ZBEKWXIAFWIING-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |