C10H4Cl2F5N — CID 12689507
N-(3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl)-4-fluorobenzenecarboximidoyl chloride (PubChem CID 12689507) has the molecular formula C10H4Cl2F5N and a molecular weight of 304.05 g/mol. Its IUPAC name is N-(3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl)-4-fluorobenzenecarboximidoyl chloride.
| Compound Name | N-(3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl)-4-fluorobenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 12689507 |
| Molecular Formula | C10H4Cl2F5N |
| Molecular Weight | 304.05 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | N-(3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl)-4-fluorobenzenecarboximidoyl chloride |
| SMILES | FC(F)=C(/N=C(\Cl)c1ccc(F)cc1)C(F)(F)Cl |
| InChI | InChI=1S/C10H4Cl2F5N/c11-8(5-1-3-6(13)4-2-5)18-7(9(14)15)10(12,16)17/h1-4H/b18-8- |
| InChIKey | XVUOIPPDDFRDEO-LSCVHKIXSA-N |
| XLogP | 4.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.05 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|