C21H22F3N5O — CID 126897319
3-propan-2-yl-7-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinazolin-4-one (PubChem CID 126897319) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 3-propan-2-yl-7-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-propan-2-yl-7-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126897319 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-propan-2-yl-7-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinazolin-4-one |
| SMILES | CC(C)n1cnc2cc(N3CCN(c4ncccc4C(F)(F)F)CC3)ccc2c1=O |
| InChI | InChI=1S/C21H22F3N5O/c1-14(2)29-13-26-18-12-15(5-6-16(18)20(29)30)27-8-10-28(11-9-27)19-17(21(22,23)24)4-3-7-25-19/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | WZFANXXVMKBMTI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |