C21H27N7O — CID 126897381
7-[4-[6-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one (PubChem CID 126897381) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 7-[4-[6-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one.
| Compound Name | 7-[4-[6-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126897381 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 7-[4-[6-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)n1cnc2cc(N3CCN(c4cc(N(C)C)ncn4)CC3)ccc2c1=O |
| InChI | InChI=1S/C21H27N7O/c1-15(2)28-14-24-18-11-16(5-6-17(18)21(28)29)26-7-9-27(10-8-26)20-12-19(25(3)4)22-13-23-20/h5-6,11-15H,7-10H2,1-4H3 |
| InChIKey | KJWNUBCOYJVFJM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |