C22H17N3 — CID 12689833
2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 12689833) has the molecular formula C22H17N3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 12689833 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H17N3/c1-16-10-8-9-15-19(16)22-24-20(17-11-4-2-5-12-17)23-21(25-22)18-13-6-3-7-14-18/h2-15H,1H3 |
| InChIKey | SWUGNDCSSFOYEZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |