C24H25N5O3 — CID 126898563
3-(2-hydroxyethyl)-7-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]quinazolin-4-one (PubChem CID 126898563) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898563 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]quinazolin-4-one |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCN(c2ccc3c(=O)n(CCO)cnc3c2)CC1 |
| InChI | InChI=1S/C24H25N5O3/c30-12-11-29-16-26-22-14-18(5-6-20(22)24(29)32)27-7-9-28(10-8-27)23(31)13-17-15-25-21-4-2-1-3-19(17)21/h1-6,14-16,25,30H,7-13H2 |
| InChIKey | LJZYXWAFPGIJHI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |