C12H21Cl2O3P — CID 12691479
(1Z)-1,2-dichloro-3-dibutoxyphosphorylbuta-1,3-diene (PubChem CID 12691479) has the molecular formula C12H21Cl2O3P and a molecular weight of 315.18 g/mol. Its IUPAC name is (1Z)-1,2-dichloro-3-dibutoxyphosphorylbuta-1,3-diene.
| Compound Name | (1Z)-1,2-dichloro-3-dibutoxyphosphorylbuta-1,3-diene |
|---|---|
| PubChem CID | 12691479 |
| Molecular Formula | C12H21Cl2O3P |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (1Z)-1,2-dichloro-3-dibutoxyphosphorylbuta-1,3-diene |
| SMILES | C=C(/C(Cl)=C/Cl)P(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C12H21Cl2O3P/c1-4-6-8-16-18(15,17-9-7-5-2)11(3)12(14)10-13/h10H,3-9H2,1-2H3/b12-10- |
| InChIKey | STKQDRZDTQDYLZ-BENRWUELSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|