C18H22N6O — CID 126917195
1-cyclopropyl-3-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methylamino]pyrazin-2-one (PubChem CID 126917195) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methylamino]pyrazin-2-one.
| Compound Name | 1-cyclopropyl-3-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 126917195 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-cyclopropyl-3-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methylamino]pyrazin-2-one |
| SMILES | O=c1c(NCC2CN(c3ccc(C4CC4)nn3)C2)nccn1C1CC1 |
| InChI | InChI=1S/C18H22N6O/c25-18-17(19-7-8-24(18)14-3-4-14)20-9-12-10-23(11-12)16-6-5-15(21-22-16)13-1-2-13/h5-8,12-14H,1-4,9-11H2,(H,19,20) |
| InChIKey | VUYRKTDQPWQFGY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |