C20H28N6 — CID 126932181
2-[(3-cyclopropylimidazol-4-yl)methyl]-5-(6-propan-2-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126932181) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 2-[(3-cyclopropylimidazol-4-yl)methyl]-5-(6-propan-2-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-[(3-cyclopropylimidazol-4-yl)methyl]-5-(6-propan-2-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126932181 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-[(3-cyclopropylimidazol-4-yl)methyl]-5-(6-propan-2-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)c1cc(N2CC3CN(Cc4cncn4C4CC4)CC3C2)ncn1 |
| InChI | InChI=1S/C20H28N6/c1-14(2)19-5-20(23-12-22-19)25-9-15-7-24(8-16(15)10-25)11-18-6-21-13-26(18)17-3-4-17/h5-6,12-17H,3-4,7-11H2,1-2H3 |
| InChIKey | ZHKHCMZXCXXCGI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |