C18H24N6OS — CID 126933813
2-[2-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(methoxymethyl)-1,3,4-thiadiazole (PubChem CID 126933813) has the molecular formula C18H24N6OS and a molecular weight of 372.50 g/mol. Its IUPAC name is 2-[2-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(methoxymethyl)-1,3,4-thiadiazole.
| Compound Name | 2-[2-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(methoxymethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 126933813 |
| Molecular Formula | C18H24N6OS |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[2-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(methoxymethyl)-1,3,4-thiadiazole |
| SMILES | COCc1nnc(N2CC3CN(c4cc(C5CCC5)ncn4)CC3C2)s1 |
| InChI | InChI=1S/C18H24N6OS/c1-25-10-17-21-22-18(26-17)24-8-13-6-23(7-14(13)9-24)16-5-15(19-11-20-16)12-3-2-4-12/h5,11-14H,2-4,6-10H2,1H3 |
| InChIKey | FAISLLASMNBVET-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |