C11H13N5 — CID 12693765
1,3,6,8,11-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene (PubChem CID 12693765) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1,3,6,8,11-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene.
| Compound Name | 1,3,6,8,11-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene |
|---|---|
| PubChem CID | 12693765 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1,3,6,8,11-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene |
| SMILES | C1=CC2N(C=C1)C1=NCCN1C1=NCCN12 |
| InChI | InChI=1S/C11H13N5/c1-2-6-14-9(3-1)15-7-4-12-11(15)16-8-5-13-10(14)16/h1-3,6,9H,4-5,7-8H2 |
| InChIKey | HAIQSHYVAVGTEW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |