C13H18N5+ — CID 92858986
(12S)-8,15-dimethyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene (PubChem CID 92858986) has the molecular formula C13H18N5+ and a molecular weight of 244.32 g/mol. Its IUPAC name is (12S)-8,15-dimethyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene.
| Compound Name | (12S)-8,15-dimethyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene |
|---|---|
| PubChem CID | 92858986 |
| Molecular Formula | C13H18N5+ |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (12S)-8,15-dimethyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene |
| SMILES | CC1=CN2C3=NCCN3C3=[N+](C)CCN3[C@@H]2C=C1 |
| InChI | InChI=1S/C13H18N5/c1-10-3-4-11-16-8-7-15(2)13(16)17-6-5-14-12(17)18(11)9-10/h3-4,9,11H,5-8H2,1-2H3/q+1/t11-/m0/s1 |
| InChIKey | ILEFVBAVKNNPHH-NSHDSACASA-N |
| XLogP | 0.09 |
| TPSA | 25.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|