C12H16IN5 — CID 139079019
(12R)-8-methyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene iodide (PubChem CID 139079019) has the molecular formula C12H16IN5 and a molecular weight of 357.20 g/mol. Its IUPAC name is (12R)-8-methyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene iodide.
| Compound Name | (12R)-8-methyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene iodide |
|---|---|
| PubChem CID | 139079019 |
| Molecular Formula | C12H16IN5 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (12R)-8-methyl-1,3,6,11-tetraza-8-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-2,7,13,15-tetraene iodide |
| SMILES | C[N+]1=C2N3CCN=C3N3C=CC=C[C@@H]3N2CC1.[I-] |
| InChI | InChI=1S/C12H16N5.HI/c1-14-8-9-16-10-4-2-3-6-15(10)11-13-5-7-17(11)12(14)16;/h2-4,6,10H,5,7-9H2,1H3;1H/q+1;/p-1/t10-;/m0./s1 |
| InChIKey | ZYYSMJFCSQLZKD-PPHPATTJSA-M |
| XLogP | -3.30 |
| TPSA | 25.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|