C20H23N3O3 — CID 126939073
6-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)oxolan-3-yl]pyridazin-3-one (PubChem CID 126939073) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)oxolan-3-yl]pyridazin-3-one.
| Compound Name | 6-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)oxolan-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126939073 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)oxolan-3-yl]pyridazin-3-one |
| SMILES | O=c1ccc(C2CC2)nn1C1COCC1NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C20H23N3O3/c24-20-6-4-16(14-2-3-14)22-23(20)18-12-25-11-17(18)21-10-13-1-5-19-15(9-13)7-8-26-19/h1,4-6,9,14,17-18,21H,2-3,7-8,10-12H2 |
| InChIKey | DRSWTNGOUYOQRI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|