C11H8N2O3 — CID 12693917
1,5-dihydrochromeno[2,3-d]pyrimidine-2,4-dione (PubChem CID 12693917) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 1,5-dihydrochromeno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,5-dihydrochromeno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12693917 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1,5-dihydrochromeno[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)Cc1ccccc1O2 |
| InChI | InChI=1S/C11H8N2O3/c14-9-7-5-6-3-1-2-4-8(6)16-10(7)13-11(15)12-9/h1-4H,5H2,(H2,12,13,14,15) |
| InChIKey | AGTIHCPHSIMRJP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |