C16H18N6 — CID 126947753
1-[1-[(2-cyclopropylpyrimidin-4-yl)methyl]pyrrolidin-3-yl]pyrazole-4-carbonitrile (PubChem CID 126947753) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-[1-[(2-cyclopropylpyrimidin-4-yl)methyl]pyrrolidin-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 1-[1-[(2-cyclopropylpyrimidin-4-yl)methyl]pyrrolidin-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 126947753 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-[1-[(2-cyclopropylpyrimidin-4-yl)methyl]pyrrolidin-3-yl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(C2CCN(Cc3ccnc(C4CC4)n3)C2)c1 |
| InChI | InChI=1S/C16H18N6/c17-7-12-8-19-22(9-12)15-4-6-21(11-15)10-14-3-5-18-16(20-14)13-1-2-13/h3,5,8-9,13,15H,1-2,4,6,10-11H2 |
| InChIKey | AETXVBMNPFNNCZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |