C11H16N4O — CID 126947667
1-[1-(2-methoxyethyl)pyrrolidin-3-yl]pyrazole-4-carbonitrile (PubChem CID 126947667) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrrolidin-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 1-[1-(2-methoxyethyl)pyrrolidin-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 126947667 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrrolidin-3-yl]pyrazole-4-carbonitrile |
| SMILES | COCCN1CCC(n2cc(C#N)cn2)C1 |
| InChI | InChI=1S/C11H16N4O/c1-16-5-4-14-3-2-11(9-14)15-8-10(6-12)7-13-15/h7-8,11H,2-5,9H2,1H3 |
| InChIKey | QJSOGXVUGKGJPU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 54.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |