C12H10N2OS — CID 126954643
2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]benzonitrile (PubChem CID 126954643) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]benzonitrile.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 126954643 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]benzonitrile |
| SMILES | Cc1csc(OCc2ccccc2C#N)n1 |
| InChI | InChI=1S/C12H10N2OS/c1-9-8-16-12(14-9)15-7-11-5-3-2-4-10(11)6-13/h2-5,8H,7H2,1H3 |
| InChIKey | MLTRRMHQYUUMQT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |