C18H19IN3O+ — CID 126956972
N-(2,4-dimethylphenyl)-2-phthalazin-2-ium-2-ylacetamide;hydroiodide (PubChem CID 126956972) has the molecular formula C18H19IN3O+ and a molecular weight of 420.27 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-phthalazin-2-ium-2-ylacetamide;hydroiodide.
| Compound Name | N-(2,4-dimethylphenyl)-2-phthalazin-2-ium-2-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 126956972 |
| Molecular Formula | C18H19IN3O+ |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-phthalazin-2-ium-2-ylacetamide;hydroiodide |
| SMILES | Cc1ccc(NC(=O)C[n+]2cc3ccccc3cn2)c(C)c1.I |
| InChI | InChI=1S/C18H17N3O.HI/c1-13-7-8-17(14(2)9-13)20-18(22)12-21-11-16-6-4-3-5-15(16)10-19-21;/h3-11H,12H2,1-2H3;1H/p+1 |
| InChIKey | ZFFIASRWDBGTOL-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 45.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|