About dipotassium 2-cyanoethyldithioimidocarbonate
dipotassium 2-cyanoethyldithioimidocarbonate (PubChem CID 126957457) has the molecular formula C4H6K2N2S2
and a molecular weight of 224.44 g/mol.
Molecular Properties
| Compound Name | dipotassium 2-cyanoethyldithioimidocarbonate |
| PubChem CID | 126957457 |
| Molecular Formula | C4H6K2N2S2 |
| Molecular Weight | 224.44 g/mol |
| Exact Mass | 223.92 |
| IUPAC Name | — |
| SMILES | N#CCCNC(=S)S.[K].[K] |
| InChI | InChI=1S/C4H6N2S2.2K/c5-2-1-3-6-4(7)8;;/h1,3H2,(H2,6,7,8);; |
| InChIKey | RODJYCVLBNQHND-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium 2-cyanoethyldithioimidocarbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium 2-cyanoethyldithioimidocarbonate?
The IUPAC name of dipotassium 2-cyanoethyldithioimidocarbonate (CID 126957457) is not available.
What is the SMILES notation for dipotassium 2-cyanoethyldithioimidocarbonate?
The canonical SMILES for dipotassium 2-cyanoethyldithioimidocarbonate is N#CCCNC(=S)S.[K].[K].
What is the InChIKey of dipotassium 2-cyanoethyldithioimidocarbonate?
The InChIKey is RODJYCVLBNQHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S2.2K/c5-2-1-3-6-4(7)8;;/h1,3H2,(H2,6,7,8);;.
What are the key properties of dipotassium 2-cyanoethyldithioimidocarbonate?
dipotassium 2-cyanoethyldithioimidocarbonate has a molecular weight of 224.44 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium 2-cyanoethyldithioimidocarbonate is sourced from PubChem (CID 126957457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).