C4H11N2O4PS4 — CID 172780597
2-(dithiocarboxyamino)ethylcarbamodithioic acid;phosphoric acid (PubChem CID 172780597) has the molecular formula C4H11N2O4PS4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;phosphoric acid.
| Compound Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;phosphoric acid |
|---|---|
| PubChem CID | 172780597 |
| Molecular Formula | C4H11N2O4PS4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;phosphoric acid |
| SMILES | O=P(O)(O)O.S=C(S)NCCNC(=S)S |
| InChI | InChI=1S/C4H8N2S4.H3O4P/c7-3(8)5-1-2-6-4(9)10;1-5(2,3)4/h1-2H2,(H2,5,7,8)(H2,6,9,10);(H3,1,2,3,4) |
| InChIKey | OEVMSQYGUNGDRH-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|