C4H9N2NaO4S5 — CID 172838822
sodium;2-(dithiocarboxyamino)ethylcarbamodithioic acid;hydrogen sulfate (PubChem CID 172838822) has the molecular formula C4H9N2NaO4S5 and a molecular weight of 332.45 g/mol. Its IUPAC name is sodium;2-(dithiocarboxyamino)ethylcarbamodithioic acid;hydrogen sulfate.
| Compound Name | sodium;2-(dithiocarboxyamino)ethylcarbamodithioic acid;hydrogen sulfate |
|---|---|
| PubChem CID | 172838822 |
| Molecular Formula | C4H9N2NaO4S5 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | sodium;2-(dithiocarboxyamino)ethylcarbamodithioic acid;hydrogen sulfate |
| SMILES | O=S(=O)([O-])O.S=C(S)NCCNC(=S)S.[Na+] |
| InChI | InChI=1S/C4H8N2S4.Na.H2O4S/c7-3(8)5-1-2-6-4(9)10;;1-5(2,3)4/h1-2H2,(H2,5,7,8)(H2,6,9,10);;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | WNDWDDVGMAIGMU-UHFFFAOYSA-M |
| XLogP | -3.40 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|