About zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid
zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid (PubChem CID 87197955) has the molecular formula C10H20N4O2S4Zn
and a molecular weight of 421.95 g/mol. Its IUPAC name is zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid.
Molecular Properties
| Compound Name | zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid |
| PubChem CID | 87197955 |
| Molecular Formula | C10H20N4O2S4Zn |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid |
| SMILES | CN(C)[C-]=O.CN(C)[C-]=O.S=C(S)NCCNC(=S)S.[Zn+2] |
| InChI | InChI=1S/C4H8N2S4.2C3H6NO.Zn/c7-3(8)5-1-2-6-4(9)10;2*1-4(2)3-5;/h1-2H2,(H2,5,7,8)(H2,6,9,10);2*1-2H3;/q;2*-1;+2 |
| InChIKey | GPOFYXXWTHMQBC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid?
The IUPAC name of zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid (CID 87197955) is zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid.
What is the SMILES notation for zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid?
The canonical SMILES for zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid is CN(C)[C-]=O.CN(C)[C-]=O.S=C(S)NCCNC(=S)S.[Zn+2].
What is the InChIKey of zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid?
The InChIKey is GPOFYXXWTHMQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S4.2C3H6NO.Zn/c7-3(8)5-1-2-6-4(9)10;2*1-4(2)3-5;/h1-2H2,(H2,5,7,8)(H2,6,9,10);2*1-2H3;/q;2*-1;+2.
What are the key properties of zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid?
zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid has a molecular weight of 421.95 g/mol, XLogP of -0.18, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;bis(dimethylaminomethanone);2-(dithiocarboxyamino)ethylcarbamodithioic acid is sourced from PubChem (CID 87197955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).