C23H27BrClN6O3+ — CID 126958668
[2-[(2Z)-2-[1-(4-chloro-2-methylanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium;hydrobromide (PubChem CID 126958668) has the molecular formula C23H27BrClN6O3+ and a molecular weight of 550.87 g/mol. Its IUPAC name is [2-[(2Z)-2-[1-(4-chloro-2-methylanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium;hydrobromide.
| Compound Name | [2-[(2Z)-2-[1-(4-chloro-2-methylanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium;hydrobromide |
|---|---|
| PubChem CID | 126958668 |
| Molecular Formula | C23H27BrClN6O3+ |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | [2-[(2Z)-2-[1-(4-chloro-2-methylanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium;hydrobromide |
| SMILES | Br.Cc1cc(Cl)ccc1NC(=O)/C(Cc1nc2ccccc2[nH]c1=O)=N\NC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C23H25ClN6O3.BrH/c1-14-11-15(24)9-10-16(14)26-23(33)20(28-29-21(31)13-30(2,3)4)12-19-22(32)27-18-8-6-5-7-17(18)25-19;/h5-11H,12-13H2,1-4H3,(H2-,26,27,29,31,32,33);1H/p+1 |
| InChIKey | NUIXXUIVZDRPEQ-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|