C23H16Cl2N6O3 — CID 5479725
N-[(Z)-[1-(3,5-dichloroanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 5479725) has the molecular formula C23H16Cl2N6O3 and a molecular weight of 495.33 g/mol. Its IUPAC name is N-[(Z)-[1-(3,5-dichloroanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[1-(3,5-dichloroanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 5479725 |
| Molecular Formula | C23H16Cl2N6O3 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[(Z)-[1-(3,5-dichloroanilino)-1-oxo-3-(3-oxo-4H-quinoxalin-2-yl)propan-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)/C(Cc1nc2ccccc2[nH]c1=O)=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C23H16Cl2N6O3/c24-14-9-15(25)11-16(10-14)27-23(34)20(30-31-21(32)13-5-7-26-8-6-13)12-19-22(33)29-18-4-2-1-3-17(18)28-19/h1-11H,12H2,(H,27,34)(H,29,33)(H,31,32)/b30-20- |
| InChIKey | QUVWDVJCYZGEHK-COEJQBHMSA-N |
| XLogP | 3.59 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|