About dilithium;ethynylbenzene
dilithium;ethynylbenzene (PubChem CID 12696041) has the molecular formula C8H4Li2
and a molecular weight of 114.00 g/mol. Its IUPAC name is dilithium;ethynylbenzene.
Molecular Properties
| Compound Name | dilithium;ethynylbenzene |
| PubChem CID | 12696041 |
| Molecular Formula | C8H4Li2 |
| Molecular Weight | 114.00 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | dilithium;ethynylbenzene |
| SMILES | [C-]#Cc1[c-]cccc1.[Li+].[Li+] |
| InChI | InChI=1S/C8H4.2Li/c1-2-8-6-4-3-5-7-8;;/h3-6H;;/q-2;2*+1 |
| InChIKey | FAKOJSYNRMDKCE-UHFFFAOYSA-N |
| XLogP | -4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.00 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dilithium;ethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;ethynylbenzene?
The IUPAC name of dilithium;ethynylbenzene (CID 12696041) is dilithium;ethynylbenzene.
What is the SMILES notation for dilithium;ethynylbenzene?
The canonical SMILES for dilithium;ethynylbenzene is [C-]#Cc1[c-]cccc1.[Li+].[Li+].
What is the InChIKey of dilithium;ethynylbenzene?
The InChIKey is FAKOJSYNRMDKCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4.2Li/c1-2-8-6-4-3-5-7-8;;/h3-6H;;/q-2;2*+1.
What are the key properties of dilithium;ethynylbenzene?
dilithium;ethynylbenzene has a molecular weight of 114.00 g/mol, XLogP of -4.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;ethynylbenzene is sourced from PubChem (CID 12696041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).