About dilithium;2-phenylethynylbenzene
dilithium;2-phenylethynylbenzene (PubChem CID 134970833) has the molecular formula C14H8Li2
and a molecular weight of 190.10 g/mol. Its IUPAC name is dilithium;2-phenylethynylbenzene.
Molecular Properties
| Compound Name | dilithium;2-phenylethynylbenzene |
| PubChem CID | 134970833 |
| Molecular Formula | C14H8Li2 |
| Molecular Weight | 190.10 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | dilithium;2-phenylethynylbenzene |
| SMILES | C(#Cc1[c-]cccc1)c1[c-]cccc1.[Li+].[Li+] |
| InChI | InChI=1S/C14H8.2Li/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h1-7,9H;;/q-2;2*+1 |
| InChIKey | CEJNHOOLDXBMQL-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.10 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-phenylethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-phenylethynylbenzene?
The IUPAC name of dilithium;2-phenylethynylbenzene (CID 134970833) is dilithium;2-phenylethynylbenzene.
What is the SMILES notation for dilithium;2-phenylethynylbenzene?
The canonical SMILES for dilithium;2-phenylethynylbenzene is C(#Cc1[c-]cccc1)c1[c-]cccc1.[Li+].[Li+].
What is the InChIKey of dilithium;2-phenylethynylbenzene?
The InChIKey is CEJNHOOLDXBMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8.2Li/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h1-7,9H;;/q-2;2*+1.
What are the key properties of dilithium;2-phenylethynylbenzene?
dilithium;2-phenylethynylbenzene has a molecular weight of 190.10 g/mol, XLogP of -3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-phenylethynylbenzene is sourced from PubChem (CID 134970833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).