C20H24ClN2O5 — CID 126963619
CID 126963619 (PubChem CID 126963619) has the molecular formula C20H24ClN2O5 and a molecular weight of 407.87 g/mol.
| Compound Name | CID 126963619 |
|---|---|
| PubChem CID | 126963619 |
| Molecular Formula | C20H24ClN2O5 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C(COCCN)[N]C(C)=C(C(=O)OC)C1c1ccccc1Cl |
| InChI | InChI=1S/C20H24ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8,17H,4,9-11,22H2,1-3H3 |
| InChIKey | UTNXXPCVBJPFJF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|