C20H25Cl2N3O5 — CID 141266543
3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-1-(chloroamino)-4-(2-chlorophenyl)-6-methyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 141266543) has the molecular formula C20H25Cl2N3O5 and a molecular weight of 458.34 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-1-(chloroamino)-4-(2-chlorophenyl)-6-methyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-1-(chloroamino)-4-(2-chlorophenyl)-6-methyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 141266543 |
| Molecular Formula | C20H25Cl2N3O5 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-1-(chloroamino)-4-(2-chlorophenyl)-6-methyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCN)N(NCl)C(C)=C(C(=O)OC)C1c1ccccc1Cl |
| InChI | InChI=1S/C20H25Cl2N3O5/c1-4-30-20(27)18-15(11-29-10-9-23)25(24-22)12(2)16(19(26)28-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,24H,4,9-11,23H2,1-3H3 |
| InChIKey | KRUCNWYKECYHSL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|